cas: 63808-36-6 — see every product listed under this CAS number, including other names
(S)-1-N-CBZ-2-CYANO-PYRROLIDINE, 98% (CAS 63808-36-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F304300-1G |
| cas | 63808-36-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1528.65 Pln | |
| Fluorochem | 10g | 2575.15 Pln | |
| Fluorochem | 25g | 5100.31 Pln | |
| Fluorochem | 100g | 12623.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl (2S)-2-cyanopyrrolidine-1-carboxylate (CAS 63808-36-6) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: benzyl (2S)-2-cyanopyrrolidine-1-carboxylate. InChIKey: AUVGQGIWVNDVSL-LBPRGKRZSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | benzyl (2S)-2-cyanopyrrolidine-1-carboxylate |
| InChIKey | AUVGQGIWVNDVSL-LBPRGKRZSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C#N |
Computed by PubChem (NCBI)