cas: 180854-44-8 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 2-ethyl 4-oxopiperidine-1,2-dicarboxylate 95% (CAS 180854-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A173163-100mg |
| cas | 180854-44-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 843.19 Pln | |
| Ambeed | 5g | 2389.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A173163 |
1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate (CAS 180854-44-8) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate. InChIKey: YAVQLRUBKDCOCI-JTQLQIEISA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate |
| InChIKey | YAVQLRUBKDCOCI-JTQLQIEISA-N |
| SMILES | CCOC(=O)[C@@H]1CC(=O)CCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)