cas: 180854-44-8 — see every product listed under this CAS number, including other names
Ethyl (S)-1-boc-4-oxopiperidine-2-carboxylate, 95%, 95% (CAS 180854-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1133ER-100mg |
| cas | 180854-44-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 842.00 Pln | |
| Chemat | 5g | 2546.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate (CAS 180854-44-8) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate. InChIKey: YAVQLRUBKDCOCI-JTQLQIEISA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate |
| InChIKey | YAVQLRUBKDCOCI-JTQLQIEISA-N |
| SMILES | CCOC(=O)[C@@H]1CC(=O)CCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)