cas: 478698-30-5 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 2-methyl 3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate, 97%, 97% (CAS 478698-30-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9PX-100mg |
| cas | 478698-30-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 846.80 Pln | |
| Chemat | 500mg | 1374.80 Pln | |
| Chemat | 1g | 2248.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate (CAS 478698-30-5) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: YBHLDAHDAOFWGW-SECBINFHSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | YBHLDAHDAOFWGW-SECBINFHSA-N |
| SMILES | CC1([C@H](N(CC1=O)C(=O)OC(C)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)