cas: 478698-30-5 — see every product listed under this CAS number, including other names
METHYL (2S)-1-BOC-3,3-DIMETHYL-4-OXOPYRROLIDINE-2-CARBOXYLATE, 98% (CAS 478698-30-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F503719-100MG |
| cas | 478698-30-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 627.92 Pln | |
| Fluorochem | 250mg | 820.56 Pln | |
| Fluorochem | 1g | 2299.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate (CAS 478698-30-5) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: YBHLDAHDAOFWGW-SECBINFHSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | YBHLDAHDAOFWGW-SECBINFHSA-N |
| SMILES | CC1([C@H](N(CC1=O)C(=O)OC(C)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)