cas: 478698-30-5 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 2-methyl 3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate, 97% (CAS 478698-30-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A948804-1g |
| cas | 478698-30-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4959.01 Pln | |
| AmBeed | 5g | 16292.92 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate (CAS 478698-30-5) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: YBHLDAHDAOFWGW-SECBINFHSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | YBHLDAHDAOFWGW-SECBINFHSA-N |
| SMILES | CC1([C@H](N(CC1=O)C(=O)OC(C)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)