(S)-2-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)-3-(4-Chloro-2-Fluorophenyl)Propanoic Acid, 98%
cas: 1217811-90-9 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)-3-(4-Chloro-2-Fluorophenyl)Propanoic Acid, 98% (CAS 1217811-90-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTTL-10mg |
| cas | 1217811-90-9 |
| size | 10mg |
| availability | 12g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 117.20 Pln | |
| Chemat | 25mg | 150.80 Pln | |
| Chemat | 50mg | 213.20 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 885.20 Pln | |
| BLDpharm | 100mg | 397.66 Pln | |
| BLDpharm | 250mg | 614.25 Pln | |
| BLDpharm | 1g | 1241.81 Pln | |
| Fluorochem | 100mg | 367.60 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 1g | 1143.37 Pln | |
| Fluorochem | 5g | 4340.16 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(4-chloro-2-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1217811-90-9) is a chemical compound with the molecular formula C24H19ClFNO4 and a molecular weight of 439.9 g/mol. IUPAC name: (2S)-3-(4-chloro-2-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: LTGUFIDCGQXZES-QFIPXVFZSA-N.
| Molecular formula | C24H19ClFNO4 |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | (2S)-3-(4-chloro-2-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | LTGUFIDCGQXZES-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=C(C=C(C=C4)Cl)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-L-2-Fluoro-4-chlorophe, Fmoc-4-chloro-2-fluoro-L-phenylalanine, N-Fmoc-4-chloro-2-fluoro-L-phenylalanine, (9H-Fluoren-9-yl)MethOxy]Carbonyl L-2-Fluoro-4-chlorophe, Fmoc-L-2-Fluoro-4-chlorophenylalanine (Fmoc-L-Phe(2-F,4-Cl)-OH), L-Phenylalanine,4-chloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-fluoro-