cas: 959573-22-9 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-carbamoylphenyl)propanoic acid, 97% (CAS 959573-22-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD318511-100mg |
| cas | 959573-22-9 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 142.20 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 414.32 Pln | |
| BLDpharm | 5g | 1669.44 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 1192.40 Pln | |
| Chemat | 25g | 3909.20 Pln | |
| Fluorochem | 25g | 5542.86 Pln | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1549.47 Pln | |
| Fluorochem | 10g | 2523.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-(3-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 959573-22-9) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: (2S)-3-(3-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: YOTDQRFXBNPJQA-QFIPXVFZSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2S)-3-(3-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | YOTDQRFXBNPJQA-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)