cas: 205526-36-9 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-cyanophenyl)propanoic acid, 97% (CAS 205526-36-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch113A72-250mg |
| cas | 205526-36-9 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 530.00 Pln | |
| Chemat | 25g | 1000.40 Pln | |
| Chemat | 100g | 3059.60 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 258.82 Pln | |
| BLDpharm | 5g | 303.25 Pln | |
| BLDpharm | 10g | 530.95 Pln | |
| BLDpharm | 25g | 1225.15 Pln | |
| Fluorochem | 1g | 180.16 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 487.35 Pln | |
| Fluorochem | 25g | 1117.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(3-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 205526-36-9) is a chemical compound with the molecular formula C25H20N2O4 and a molecular weight of 412.4 g/mol. IUPAC name: (2S)-3-(3-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CVLOUTPKZUJTGV-QHCPKHFHSA-N.
| Molecular formula | C25H20N2O4 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | (2S)-3-(3-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CVLOUTPKZUJTGV-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)C#N)C(=O)O |
Computed by PubChem (NCBI)