(S)-2-(((Benzyloxy)Carbonyl)Amino)-3,3-Dicyclopropylpropanoic Acid, 98%
cas: 2755148-69-5 — see every product listed under this CAS number, including other names
(S)-2-(((Benzyloxy)Carbonyl)Amino)-3,3-Dicyclopropylpropanoic Acid, 98% (CAS 2755148-69-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch13ACML-100mg |
| cas | 2755148-69-5 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2541.20 Pln | |
| Chemat | 10g | 4542.80 Pln | |
| BLDpharm | 100mg | 397.66 Pln | |
| BLDpharm | 250mg | 647.57 Pln | |
| BLDpharm | 1g | 1663.88 Pln | |
| BLDpharm | 5g | 4601.74 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 2755148-69-5) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: (2S)-3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: IDTCHXZZKVSJHV-HNNXBMFYSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (2S)-3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | IDTCHXZZKVSJHV-HNNXBMFYSA-N |
| SMILES | C1CC1C(C2CC2)[C@@H](C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)