CAS 391234-97-2 appears in our catalog under these names: Fenoterol EP Impurity A (R,S-Isomer), 2S, 5R-Fenoterol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
5-[(1R)-1-hydroxy-2-[[(2S)-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]benzene-1,3-diol (CAS 391234-97-2) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: 5-[(1R)-1-hydroxy-2-[[(2S)-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]benzene-1,3-diol. InChIKey: LSLYOANBFKQKPT-GTNSWQLSSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | 5-[(1R)-1-hydroxy-2-[[(2S)-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]benzene-1,3-diol |
| InChIKey | LSLYOANBFKQKPT-GTNSWQLSSA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)O)NC[C@@H](C2=CC(=CC(=C2)O)O)O |
Computed by PubChem (NCBI)