Products 2755148-69-5
CAS 2755148-69-5 appears in our catalog under these names: Cbz-3,3-DicPr-Ala-OH 98%, (S)-2-(((Benzyloxy)carbonyl)amino)-3,3-dicyclopropylpropanoic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 2755148-69-5) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: (2S)-3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: IDTCHXZZKVSJHV-HNNXBMFYSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (2S)-3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | IDTCHXZZKVSJHV-HNNXBMFYSA-N |
| SMILES | C1CC1C(C2CC2)[C@@H](C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)