cas: 225918-60-5 — see every product listed under this CAS number, including other names
(S)-2-((tert-Butoxycarbonyl)amino)-2-(2-chlorophenyl)acetic acid, 97% (CAS 225918-60-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F606109-1G |
| cas | 225918-60-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 5g | 2059.71 Pln | |
| Fluorochem | 25g | 5355.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 225918-60-5) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: (2S)-2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: XPFJZGJBRMTXCE-JTQLQIEISA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | (2S)-2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | XPFJZGJBRMTXCE-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC=CC=C1Cl)C(=O)O |
Computed by PubChem (NCBI)