CAS 313490-25-4 appears in our catalog under these names: tert-Butoxycarbonylamino-(2-chloro-phenyl)-acetic acid, 95%, 2–((tert–Butoxycarbonyl)amino)–2–(2–chlorophenyl)acetic acid, 2-((tert-Butoxycarbonyl)amino)-2-(2-chlorophenyl)acetic acid, 98%, 98%, N-Boc-(2'-Chlorophenyl)glycine, 98%, Boc-DL-Phg(2-Cl)-OH, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 313490-25-4) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: XPFJZGJBRMTXCE-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | XPFJZGJBRMTXCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=CC=C1Cl)C(=O)O |
Computed by PubChem (NCBI)