CAS 53994-85-7 appears in our catalog under these names: (R)-tert-Butoxycarbonylamino-(4-chloro-phenyl)-acetic acid, 95%, Boc-D-Phg(4-Cl)-OH, 98%, 98%, N-Boc-2-(4'-Chlorophenyl)-D-glycine, 98%, Boc-D-Phg(4-Cl)-OH, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 50mg.
(2R)-2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 53994-85-7) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: (2R)-2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZZONJNNLTAGSHB-SNVBAGLBSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | (2R)-2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZZONJNNLTAGSHB-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)