CAS 209525-73-5 appears in our catalog under these names: N-Boc-(4'-chlorophenyl)glycine, 96%, 2–((tert–Butoxycarbonyl)amino)–2–(4–chlorophenyl)acetic acid, 2-((tert-Butoxycarbonyl)amino)-2-(4-chlorophenyl)acetic acid, 97%, 97%, 2-((tert-Butoxycarbonyl)amino)-2-(4-chlorophenyl)acetic acid, 98%, Boc-DL-Phg(4-Cl)-OH, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 209525-73-5) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZZONJNNLTAGSHB-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZZONJNNLTAGSHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)