Products 1632286-03-3

CAS 1632286-03-3 is the registry number for (4-Chloro-2-formyl-5-methoxy-phenyl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(4-chloro-2-formyl-5-methoxyphenyl)carbamate (CAS 1632286-03-3) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: tert-butyl N-(4-chloro-2-formyl-5-methoxyphenyl)carbamate. InChIKey: GGJHFLREQOGOAT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClNO4
Molecular weight285.72 g/mol
IUPAC nametert-butyl N-(4-chloro-2-formyl-5-methoxyphenyl)carbamate
InChIKeyGGJHFLREQOGOAT-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC(=C(C=C1C=O)Cl)OC

Computed by PubChem (NCBI)