cas: 2206230-32-0 — see every product listed under this CAS number, including other names
(S)-2-(4-METHYLPIPERAZIN-1-YL)PROPANOIC ACID HCL, 95% (CAS 2206230-32-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A843271-250mg |
| cas | 2206230-32-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 3032.05 Pln | |
| AmBeed | 1g | 7517.44 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-(4-methylpiperazin-1-yl)propanoic acid;hydrochloride (CAS 2206230-32-0) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: (2R)-2-(4-methylpiperazin-1-yl)propanoic acid;hydrochloride. InChIKey: ZQWZGCIPCQYNMB-OGFXRTJISA-N.
| Molecular formula | C8H17ClN2O2 |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | (2R)-2-(4-methylpiperazin-1-yl)propanoic acid;hydrochloride |
| InChIKey | ZQWZGCIPCQYNMB-OGFXRTJISA-N |
| SMILES | C[C@H](C(=O)O)N1CCN(CC1)C.Cl |
Computed by PubChem (NCBI)