Products 1049722-10-2

CAS 1049722-10-2 is the registry number for N-Alloc-1,4-butandiamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Prop-2-enyl N-(4-aminobutyl)carbamate;hydrochloride (CAS 1049722-10-2) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: prop-2-enyl N-(4-aminobutyl)carbamate;hydrochloride. InChIKey: QEQBSZVBKDDMTE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2O2
Molecular weight208.68 g/mol
IUPAC nameprop-2-enyl N-(4-aminobutyl)carbamate;hydrochloride
InChIKeyQEQBSZVBKDDMTE-UHFFFAOYSA-N
SMILESC=CCOC(=O)NCCCCN.Cl

Computed by PubChem (NCBI)