Products 2206230-32-0
CAS 2206230-32-0 appears in our catalog under these names: (R)-2-(4-Methylpiperazin-1-yl)propanoic acid hydrochloride, 95%, (S)-2-(4-METHYLPIPERAZIN-1-YL)PROPANOIC ACID HCL, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2R)-2-(4-methylpiperazin-1-yl)propanoic acid;hydrochloride (CAS 2206230-32-0) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: (2R)-2-(4-methylpiperazin-1-yl)propanoic acid;hydrochloride. InChIKey: ZQWZGCIPCQYNMB-OGFXRTJISA-N.
| Molecular formula | C8H17ClN2O2 |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | (2R)-2-(4-methylpiperazin-1-yl)propanoic acid;hydrochloride |
| InChIKey | ZQWZGCIPCQYNMB-OGFXRTJISA-N |
| SMILES | C[C@H](C(=O)O)N1CCN(CC1)C.Cl |
Computed by PubChem (NCBI)