Products 1216609-00-5

CAS 1216609-00-5 is the registry number for 2-(4-Ethylpiperazin-1-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4-ethylpiperazin-1-yl)acetic acid;hydrochloride (CAS 1216609-00-5) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: 2-(4-ethylpiperazin-1-yl)acetic acid;hydrochloride. InChIKey: CVDVSNPNGGCQCB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2O2
Molecular weight208.68 g/mol
IUPAC name2-(4-ethylpiperazin-1-yl)acetic acid;hydrochloride
InChIKeyCVDVSNPNGGCQCB-UHFFFAOYSA-N
SMILESCCN1CCN(CC1)CC(=O)O.Cl

Computed by PubChem (NCBI)