CAS 1210273-37-2 appears in our catalog under these names: tert-Butyl 3-aminoazetidine-1-carboxylate hydrochloride, 96%, tert-Butyl 3-aminoazetidine-1-carboxylate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl 3-aminoazetidine-1-carboxylate;hydrochloride (CAS 1210273-37-2) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: tert-butyl 3-aminoazetidine-1-carboxylate;hydrochloride. InChIKey: RBTVSNLYYIMMKS-UHFFFAOYSA-N.
| Molecular formula | C8H17ClN2O2 |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | tert-butyl 3-aminoazetidine-1-carboxylate;hydrochloride |
| InChIKey | RBTVSNLYYIMMKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)N.Cl |
Computed by PubChem (NCBI)