cas: 201594-84-5 — see every product listed under this CAS number, including other names
(S)-2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine, 96%, 96% (CAS 201594-84-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DIM-100mg |
| cas | 201594-84-5 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 25g | 630.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine (CAS 201594-84-5) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: 2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine. InChIKey: OTZYADIPHOGUDN-KRWDZBQOSA-N.
| Molecular formula | C17H19ClN2O |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine |
| InChIKey | OTZYADIPHOGUDN-KRWDZBQOSA-N |
| SMILES | C1CNCCC1O[C@@H](C2=CC=C(C=C2)Cl)C3=CC=CC=N3 |
Computed by PubChem (NCBI)