cas: 201594-84-5 — see every product listed under this CAS number, including other names
2-{s-(4-Chlorophenyl)(4-Piperidinyloxy)Methyl}Pyridine, 99.95% (CAS 201594-84-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 500 mg, 25 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-32242-5 g |
| cas | 201594-84-5 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 542.60 Pln | |
| MedChemExpress | 10 g | 793.38 Pln | |
| MedChemExpress | 500 mg | 240.74 Pln | |
| MedChemExpress | 25 g | 1462.12 Pln | |
| MedChemExpress | 1 g | 287.18 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.95% |
2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine (CAS 201594-84-5) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: 2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine. InChIKey: OTZYADIPHOGUDN-KRWDZBQOSA-N.
| Molecular formula | C17H19ClN2O |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine |
| InChIKey | OTZYADIPHOGUDN-KRWDZBQOSA-N |
| SMILES | C1CNCCC1O[C@@H](C2=CC=C(C=C2)Cl)C3=CC=CC=N3 |
Computed by PubChem (NCBI)