cas: 4299-70-1 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-(1H-indol-3-yl)-propionic acid methyl ester, 95% (CAS 4299-70-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F060295-1G |
| cas | 4299-70-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 789.32 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate (CAS 4299-70-1) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate. InChIKey: KCUNTYMNJVXYKZ-JTQLQIEISA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
| InChIKey | KCUNTYMNJVXYKZ-JTQLQIEISA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)N |
Computed by PubChem (NCBI)