cas: 2231249-10-6 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-hydroxy-3-methylbutanoic acid hcl, 95%, 95% (CAS 2231249-10-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12V5LU-1g |
| cas | 2231249-10-6 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3251.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-hydroxy-3-methylbutanoic acid;hydrochloride (CAS 2231249-10-6) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: (2S)-2-amino-3-hydroxy-3-methylbutanoic acid;hydrochloride. InChIKey: JWMNLDPWYMQUBU-AENDTGMFSA-N.
| Molecular formula | C5H12ClNO3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (2S)-2-amino-3-hydroxy-3-methylbutanoic acid;hydrochloride |
| InChIKey | JWMNLDPWYMQUBU-AENDTGMFSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)