Products 2679832-44-9

CAS 2679832-44-9 is the registry number for (S)-2-Cyclohexyl-2-(2,2,2-trifluoroacetamido)acetic acid, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (CAS 2679832-44-9) is a chemical compound with the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. IUPAC name: (2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid. InChIKey: SELLUZIYVGEZCW-ZETCQYMHSA-N.

Identity
Molecular formulaC10H14F3NO3
Molecular weight253.22 g/mol
IUPAC name(2S)-2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid
InChIKeySELLUZIYVGEZCW-ZETCQYMHSA-N
SMILESC1CCC(CC1)[C@@H](C(=O)O)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)