cas: 332062-08-5 — see every product listed under this CAS number, including other names
(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4,4-diphenylbutanoic acid, 98%, 98% (CAS 332062-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CNF-100mg |
| cas | 332062-08-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 904.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid (CAS 332062-08-5) is a chemical compound with the molecular formula C31H27NO4 and a molecular weight of 477.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid. InChIKey: GQRZIYGFRVKFSB-NDEPHWFRSA-N.
| Molecular formula | C31H27NO4 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid |
| InChIKey | GQRZIYGFRVKFSB-NDEPHWFRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)