cas: 332062-08-5 — see every product listed under this CAS number, including other names
Fmoc-S-3-amino-4,4-diphenyl-butyric acid, 99.96% (CAS 332062-08-5) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 100 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W112057-1 g |
| cas | 332062-08-5 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1132.39 Pln | |
| MedChemExpress | 100 mg | 394.00 Pln | |
| MedChemExpress | 250 mg | 575.11 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.96% |
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid (CAS 332062-08-5) is a chemical compound with the molecular formula C31H27NO4 and a molecular weight of 477.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid. InChIKey: GQRZIYGFRVKFSB-NDEPHWFRSA-N.
| Molecular formula | C31H27NO4 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid |
| InChIKey | GQRZIYGFRVKFSB-NDEPHWFRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)