cas: 332062-08-5 — see every product listed under this CAS number, including other names
FMOC-(S)-3-AMINO-4,4-DIPHENYL-BUTYRIC ACID, 98% (CAS 332062-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F841881-100MG |
| cas | 332062-08-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 872.63 Pln | |
| Fluorochem | 5g | 4131.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid (CAS 332062-08-5) is a chemical compound with the molecular formula C31H27NO4 and a molecular weight of 477.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid. InChIKey: GQRZIYGFRVKFSB-NDEPHWFRSA-N.
| Molecular formula | C31H27NO4 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid |
| InChIKey | GQRZIYGFRVKFSB-NDEPHWFRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)