(S)-3-((tert-Butoxycarbonyl)amino)-3-(2-fluorophenyl)propanoic acid, 97%
cas: 500770-71-8 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-3-(2-fluorophenyl)propanoic acid, 97% (CAS 500770-71-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD117583-100mg |
| cas | 500770-71-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 319.91 Pln | |
| BLDpharm | 1g | 697.56 Pln | |
| BLDpharm | 5g | 2452.49 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 2138.00 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 1117.33 Pln | |
| Fluorochem | 5g | 3954.88 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-(2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 500770-71-8) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (3S)-3-(2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RJWRQSGZCKYLML-NSHDSACASA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (3S)-3-(2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RJWRQSGZCKYLML-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=CC=C1F |
Computed by PubChem (NCBI)
Synonyms:
(S)-3-((tert-Butoxycarbonyl)amino)-3-(2-fluorophenyl)propanoic acid, Boc-(S)-3-Amino-3-(2-fluoro-phenyl)-propionic acid, Boc-beta-Phe(2-F)-OH, (3S)-3-{[(tert-butoxy)carbonyl]amino}-3-(2-fluorophenyl)propanoic acid, (3S)-3-(2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid, Boc-S-3-Amino-3-(2-fluorophenyl)propionic acid, Boc-b-Phe(2-F)-OH, (S)-Boc-beta-Phe(2-F)-OH, (S)-3-(Boc-amino)-3-(2-fluorophenyl)propanoic Acid, (3S)-3-(tert-butoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid