Products 2270913-62-5
CAS 2270913-62-5 is the registry number for 3-(4-Fluoro-3-hydroxy-phenoxy)-azetidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 3-(4-fluoro-3-hydroxyphenoxy)azetidine-1-carboxylate (CAS 2270913-62-5) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: tert-butyl 3-(4-fluoro-3-hydroxyphenoxy)azetidine-1-carboxylate. InChIKey: DUOMEMQFLZPLJY-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | tert-butyl 3-(4-fluoro-3-hydroxyphenoxy)azetidine-1-carboxylate |
| InChIKey | DUOMEMQFLZPLJY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)OC2=CC(=C(C=C2)F)O |
Computed by PubChem (NCBI)