CAS 129101-25-3 appears in our catalog under these names: Boc-p-fluoro-dl-phe-oh, 98%, Boc–p–fluoro–DL–Phe–OH, 2-((Tert-Butoxycarbonyl)Amino)-3-(4-Fluorophenyl)Propanoic Acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 129101-25-3) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: 3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RCXSXRAUMLKRRL-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RCXSXRAUMLKRRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)