CAS 284493-59-0 appears in our catalog under these names: 3-[(tert-Butoxycarbonyl)amino]-3-(3-fluorophenyl)propanoic acid, 95%, 3–((tert–butoxycarbonyl)amino)–3–(3–fluorophenyl)propanoic acid. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 284493-59-0) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: 3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: IQPQPXUDXQDVMK-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | IQPQPXUDXQDVMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC(=CC=C1)F |
Computed by PubChem (NCBI)