CAS 114873-00-6 appears in our catalog under these names: Boc–Phe(2–F)–OH, Boc-L-Phe(2-F)-OH, Boc-Phe(2-F)-OH, 97%, 97%, Boc-l-2-Fluorophenylalanine, 98%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g.
(2S)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 114873-00-6) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2S)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: NTWUXBKUDXGMHV-NSHDSACASA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2S)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | NTWUXBKUDXGMHV-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1F)C(=O)O |
Computed by PubChem (NCBI)