cas: 270063-54-2 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-4-(3,4-difluorophenyl)butanoic acid, 98%, 98% (CAS 270063-54-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I65I-50mg |
| cas | 270063-54-2 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 194.00 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1163.60 Pln | |
| Chemat | 100mg | 270.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-4-(3,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 270063-54-2) is a chemical compound with the molecular formula C15H19F2NO4 and a molecular weight of 315.31 g/mol. IUPAC name: (3S)-4-(3,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: XZGBRONJONQTTA-JTQLQIEISA-N.
| Molecular formula | C15H19F2NO4 |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | (3S)-4-(3,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | XZGBRONJONQTTA-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C=C1)F)F)CC(=O)O |
Computed by PubChem (NCBI)