CAS 1872383-15-7 is the registry number for tert-Butyl 3-(3,6-difluoro-2-methoxyphenyl)-3-hydroxyazetidine-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(3,6-difluoro-2-methoxyphenyl)-3-hydroxyazetidine-1-carboxylate (CAS 1872383-15-7) is a chemical compound with the molecular formula C15H19F2NO4 and a molecular weight of 315.31 g/mol. IUPAC name: tert-butyl 3-(3,6-difluoro-2-methoxyphenyl)-3-hydroxyazetidine-1-carboxylate. InChIKey: KHPYQWLIEBGECP-UHFFFAOYSA-N.
| Molecular formula | C15H19F2NO4 |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | tert-butyl 3-(3,6-difluoro-2-methoxyphenyl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | KHPYQWLIEBGECP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=C(C=CC(=C2OC)F)F)O |
Computed by PubChem (NCBI)