Products 1260592-48-0
CAS 1260592-48-0 is the registry number for (S)-3-((tert-Butoxycarbonyl)amino)-2-(2,3-difluorobenzyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(2,3-difluorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1260592-48-0) is a chemical compound with the molecular formula C15H19F2NO4 and a molecular weight of 315.31 g/mol. IUPAC name: (2S)-2-[(2,3-difluorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: SYBNWACGAPAHGD-JTQLQIEISA-N.
| Molecular formula | C15H19F2NO4 |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | (2S)-2-[(2,3-difluorophenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | SYBNWACGAPAHGD-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](CC1=C(C(=CC=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)