CAS 1824443-71-1 is the registry number for Sitagliptin Impurity 3 . Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1824443-71-1) is a chemical compound with the molecular formula C15H19F2NO4 and a molecular weight of 315.31 g/mol. IUPAC name: 4-(2,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LUYHWLQWAVCDNA-UHFFFAOYSA-N.
| Molecular formula | C15H19F2NO4 |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LUYHWLQWAVCDNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=C(C=C(C=C1)F)F)CC(=O)O |
Computed by PubChem (NCBI)