CAS 176795-00-9 is the registry number for methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-3-(3,4-difluorophenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 176795-00-9) is a chemical compound with the molecular formula C15H19F2NO4 and a molecular weight of 315.31 g/mol. IUPAC name: methyl (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: BTZZCDKMYKDYQM-GFCCVEGCSA-N.
| Molecular formula | C15H19F2NO4 |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | methyl (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | BTZZCDKMYKDYQM-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1)F)F)C(=O)OC |
Computed by PubChem (NCBI)