cas: 132549-43-0 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid, 98%, 98% (CAS 132549-43-0) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1121TA-50g |
| cas | 132549-43-0 |
| size | 50g |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 2896.40 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 501.20 Pln | |
| Chemat | 10g | 933.20 Pln | |
| Chemat | 25g | 1605.20 Pln | |
| Chemat | 100g | 5234.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 132549-43-0) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: XRVAMBSTOWHUMM-VIFPVBQESA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | XRVAMBSTOWHUMM-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)