CAS 146398-18-7 appears in our catalog under these names: (R)-3-((tert-Butoxycarbonyl)amino)-5-methylhexanoic acid, 95%, (R)-3-((tert-Butoxycarbonyl)amino)-5-methylhexanoic Acid, Boc–D–beta–homoleucine, (3R)-3-{((tert-butoxy)carbonyl)amino}-5-methylhexanoic acid, Boc-D-β-HoLeu-OH 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 5g, 10g, 25g, 500mg.
(3R)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 146398-18-7) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (3R)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: XRVAMBSTOWHUMM-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (3R)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | XRVAMBSTOWHUMM-SECBINFHSA-N |
| SMILES | CC(C)C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)