cas: 479065-00-4 — see every product listed under this CAS number, including other names
(S)-3-(p-Methylphenyl)-beta-alanine, 97%, 97% (CAS 479065-00-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9QC-50mg |
| cas | 479065-00-4 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 131.60 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 630.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-amino-3-(4-methylphenyl)propanoic acid (CAS 479065-00-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3S)-3-amino-3-(4-methylphenyl)propanoic acid. InChIKey: XPDAKEOBPKFUAH-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-methylphenyl)propanoic acid |
| InChIKey | XPDAKEOBPKFUAH-VIFPVBQESA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)