(S)-3-Amino-3-(4-chloro-phenyl)-propionic acid, 98%, 98%
cas: 131690-60-3 — see every product listed under this CAS number, including other names
(S)-3-Amino-3-(4-chloro-phenyl)-propionic acid, 98%, 98% (CAS 131690-60-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ZKQ-100mg |
| cas | 131690-60-3 |
| size | 100mg |
| availability | 175g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 938.00 Pln | |
| Chemat | 10g | 1773.20 Pln | |
| Chemat | 25g | 3011.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-amino-3-(4-chlorophenyl)propanoic acid (CAS 131690-60-3) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3S)-3-amino-3-(4-chlorophenyl)propanoic acid. InChIKey: BXGDBHAMTMMNTO-QMMMGPOBSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-chlorophenyl)propanoic acid |
| InChIKey | BXGDBHAMTMMNTO-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3-amino-3-(4-chlorophenyl)propanoic acid, (S)-3-Amino-3-(4-chloro-phenyl)-propionic acid, (s)-3-amino-3-(4-chlorophenyl)propanoic acid, (s)-3-amino-3-(4-chlorophenyl)propionic acid, (S)-beta-(p-Chlorophenyl)alanine, Benzenepropanoic acid, beta-amino-4-chloro-, (betaS)-, h-d-phg(4-cl)-(c*ch2)oh, (s)-beta-4-chlorophenylalanine, h-beta-phe(4-cl)-oh, (s)-4-chloro-beta-phenylalanine