cas: 131690-60-3 — see every product listed under this CAS number, including other names
H-β-Phe(4-Cl)-OH 98% (CAS 131690-60-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A312618-100mg |
| cas | 131690-60-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 960.00 Pln | |
| Ambeed | 10g | 1510.69 Pln | |
| Ambeed | 25g | 2951.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A312618 |
(3S)-3-amino-3-(4-chlorophenyl)propanoic acid (CAS 131690-60-3) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3S)-3-amino-3-(4-chlorophenyl)propanoic acid. InChIKey: BXGDBHAMTMMNTO-QMMMGPOBSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-chlorophenyl)propanoic acid |
| InChIKey | BXGDBHAMTMMNTO-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)Cl |
Computed by PubChem (NCBI)