cas: 119904-90-4 — see every product listed under this CAS number, including other names
(S)-3-Aminoquinuclidine dihydrochloride, 97%, 97% (CAS 119904-90-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11438P-250mg |
| cas | 119904-90-4 |
| size | 250mg |
| availability | 109g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 510.80 Pln | |
| Chemat | 100g | 1715.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (CAS 119904-90-4) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride. InChIKey: STZHBULOYDCZET-XCUBXKJBSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| InChIKey | STZHBULOYDCZET-XCUBXKJBSA-N |
| SMILES | C1CN2CCC1[C@@H](C2)N.Cl.Cl |
Computed by PubChem (NCBI)