cas: 119904-90-4 — see every product listed under this CAS number, including other names
(S)-Quinuclidin-3-amine (dihydrochloride), 99.97% (CAS 119904-90-4) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 25 g, 10 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-I0034-5 g |
| cas | 119904-90-4 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 310.40 Pln | |
| MedChemExpress | 25 g | 816.60 Pln | |
| MedChemExpress | 10 g | 431.15 Pln | |
| MedChemExpress | 1 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.97% |
(3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (CAS 119904-90-4) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride. InChIKey: STZHBULOYDCZET-XCUBXKJBSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| InChIKey | STZHBULOYDCZET-XCUBXKJBSA-N |
| SMILES | C1CN2CCC1[C@@H](C2)N.Cl.Cl |
Computed by PubChem (NCBI)