cas: 119904-90-4 — see every product listed under this CAS number, including other names
(S)-3-Aminoquinuclidine dihydrochloride, 97% (CAS 119904-90-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093049-1G |
| cas | 119904-90-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 310.33 Pln | |
| Fluorochem | 25g | 674.78 Pln | |
| Fluorochem | 100g | 2392.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (CAS 119904-90-4) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride. InChIKey: STZHBULOYDCZET-XCUBXKJBSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (3S)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| InChIKey | STZHBULOYDCZET-XCUBXKJBSA-N |
| SMILES | C1CN2CCC1[C@@H](C2)N.Cl.Cl |
Computed by PubChem (NCBI)