cas: 270062-85-6 — see every product listed under this CAS number, including other names
(S)-4-(4-Bromophenyl)-3-((tert-butoxycarbonyl)amino)butanoic acid, 98% (CAS 270062-85-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F449477-250MG |
| cas | 270062-85-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 500mg | 513.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-4-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 270062-85-6) is a chemical compound with the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. IUPAC name: (3S)-4-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: GYXZKHKUVVKDHI-LBPRGKRZSA-N.
| Molecular formula | C15H20BrNO4 |
|---|---|
| Molecular weight | 358.23 g/mol |
| IUPAC name | (3S)-4-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | GYXZKHKUVVKDHI-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)Br)CC(=O)O |
Computed by PubChem (NCBI)