cas: 1980007-51-9 — see every product listed under this CAS number, including other names
(S)-6-(tert-Butoxycarbonyl)-6-azaspiro[3.4]octane-7-carboxylic acid, 98% (CAS 1980007-51-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12W9F7-100mg |
| cas | 1980007-51-9 |
| size | 100mg |
| availability | 1.65g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 645.20 Pln | |
| Chemat | 250mg | 1514.00 Pln | |
| Chemat | 1g | 3770.00 Pln | |
| Fluorochem | 100mg | 1106.92 Pln | |
| Fluorochem | 250mg | 2137.81 Pln | |
| Fluorochem | 1g | 5272.12 Pln | |
| Fluorochem | 5g | 18111.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(7S)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid (CAS 1980007-51-9) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (7S)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid. InChIKey: HZKVXWNBWVIDGE-VIFPVBQESA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (7S)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octane-7-carboxylic acid |
| InChIKey | HZKVXWNBWVIDGE-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCC2)C[C@H]1C(=O)O |
Computed by PubChem (NCBI)